C26H32O4Si — CID 166484641
methyl 5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate (PubChem CID 166484641) has the molecular formula C26H32O4Si and a molecular weight of 436.62 g/mol. Its IUPAC name is methyl 5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate.
| Compound Name | methyl 5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
|---|---|
| PubChem CID | 166484641 |
| Molecular Formula | C26H32O4Si |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | methyl 5-[tert-butyl(diphenyl)silyl]oxy-2-oxo-3,3a,4,5,6,6a-hexahydro-1H-pentalene-1-carboxylate |
| SMILES | COC(=O)C1C(=O)CC2CC(O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC21 |
| InChI | InChI=1S/C26H32O4Si/c1-26(2,3)31(20-11-7-5-8-12-20,21-13-9-6-10-14-21)30-19-15-18-16-23(27)24(22(18)17-19)25(28)29-4/h5-14,18-19,22,24H,15-17H2,1-4H3 |
| InChIKey | GZOPOELCDNGEJG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|