C14H17N3O2S2 — CID 16648494
(5E)-3-[(4-methylpiperazin-1-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione (PubChem CID 16648494) has the molecular formula C14H17N3O2S2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (5E)-3-[(4-methylpiperazin-1-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-3-[(4-methylpiperazin-1-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 16648494 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (5E)-3-[(4-methylpiperazin-1-yl)methyl]-5-(thiophen-2-ylmethylidene)-1,3-thiazolidine-2,4-dione |
| SMILES | CN1CCN(CN2C(=O)S/C(=C/c3cccs3)C2=O)CC1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-15-4-6-16(7-5-15)10-17-13(18)12(21-14(17)19)9-11-3-2-8-20-11/h2-3,8-9H,4-7,10H2,1H3/b12-9+ |
| InChIKey | IEXMOBBMOAJFDW-FMIVXFBMSA-N |
| XLogP | 1.99 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|