C20H28O2 — CID 166485088
ethane;13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 166485088) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is ethane;13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | ethane;13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 166485088 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | ethane;13-methyl-6,7,8,9,11,12,14,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC.CC12CCC3c4ccc(O)cc4CCC3C1C=CC2O |
| InChI | InChI=1S/C18H22O2.C2H6/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;1-2/h3,5-7,10,14-17,19-20H,2,4,8-9H2,1H3;1-2H3 |
| InChIKey | SNHKCAXWVGHMMO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|