About [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride
[3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride (PubChem CID 166485557) has the molecular formula C12H17Cl3N6O
and a molecular weight of 367.67 g/mol. Its IUPAC name is [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride.
Molecular Properties
| Compound Name | [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride |
| PubChem CID | 166485557 |
| Molecular Formula | C12H17Cl3N6O |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1nc(-c2cnc(N3CCNCC3)c(Cl)c2)no1 |
| InChI | InChI=1S/C12H15ClN6O.2ClH/c13-9-5-8(11-17-10(6-14)20-18-11)7-16-12(9)19-3-1-15-2-4-19;;/h5,7,15H,1-4,6,14H2;2*1H |
| InChIKey | HTNUPQXPJDICDG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The IUPAC name of [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride (CID 166485557) is [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride.
What is the SMILES notation for [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The canonical SMILES for [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride is Cl.Cl.NCc1nc(-c2cnc(N3CCNCC3)c(Cl)c2)no1.
What is the InChIKey of [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
The InChIKey is HTNUPQXPJDICDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN6O.2ClH/c13-9-5-8(11-17-10(6-14)20-18-11)7-16-12(9)19-3-1-15-2-4-19;;/h5,7,15H,1-4,6,14H2;2*1H.
What are the key properties of [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride?
[3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride has a molecular weight of 367.67 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-chloro-6-piperazin-1-yl-3-pyridinyl)-1,2,4-oxadiazol-5-yl]methanamine;dihydrochloride is sourced from PubChem (CID 166485557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).