C12H23NO — CID 166485650
2,2,4-trimethyl-4-pyrrolidin-2-ylpentanal (PubChem CID 166485650) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 2,2,4-trimethyl-4-pyrrolidin-2-ylpentanal.
| Compound Name | 2,2,4-trimethyl-4-pyrrolidin-2-ylpentanal |
|---|---|
| PubChem CID | 166485650 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2,2,4-trimethyl-4-pyrrolidin-2-ylpentanal |
| SMILES | CC(C)(C=O)CC(C)(C)C1CCCN1 |
| InChI | InChI=1S/C12H23NO/c1-11(2,9-14)8-12(3,4)10-6-5-7-13-10/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | WOINCBZSROYPSU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|