About (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol
(S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol (PubChem CID 166485711) has the molecular formula C7H12N4O
and a molecular weight of 168.20 g/mol. Its IUPAC name is (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol.
Molecular Properties
| Compound Name | (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol |
| PubChem CID | 166485711 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol |
| SMILES | O[C@H](c1ncn[nH]1)C1CCCN1 |
| InChI | InChI=1S/C7H12N4O/c12-6(5-2-1-3-8-5)7-9-4-10-11-7/h4-6,8,12H,1-3H2,(H,9,10,11)/t5?,6-/m0/s1 |
| InChIKey | NULPWNHUIFZJBP-GDVGLLTNSA-N |
| XLogP | -0.41 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol?
The IUPAC name of (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol (CID 166485711) is (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol.
What is the SMILES notation for (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol?
The canonical SMILES for (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol is O[C@H](c1ncn[nH]1)C1CCCN1.
What is the InChIKey of (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol?
The InChIKey is NULPWNHUIFZJBP-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H12N4O/c12-6(5-2-1-3-8-5)7-9-4-10-11-7/h4-6,8,12H,1-3H2,(H,9,10,11)/t5?,6-/m0/s1.
What are the key properties of (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol?
(S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol has a molecular weight of 168.20 g/mol, XLogP of -0.41, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-pyrrolidin-2-yl(1H-1,2,4-triazol-5-yl)methanol is sourced from PubChem (CID 166485711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).