About 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium
2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium (PubChem CID 166486218) has the molecular formula C9H13NO2Y
and a molecular weight of 256.11 g/mol. Its IUPAC name is 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium.
Molecular Properties
| Compound Name | 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium |
| PubChem CID | 166486218 |
| Molecular Formula | C9H13NO2Y |
| Molecular Weight | 256.11 g/mol |
| Exact Mass | 256.00 |
| IUPAC Name | 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium |
| SMILES | CO.Oc1ccc2c(c1)CNC2.[Y] |
| InChI | InChI=1S/C8H9NO.CH4O.Y/c10-8-2-1-6-4-9-5-7(6)3-8;1-2;/h1-3,9-10H,4-5H2;2H,1H3; |
| InChIKey | SBFUUQSQFBCVQC-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.11 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium?
The IUPAC name of 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium (CID 166486218) is 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium.
What is the SMILES notation for 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium?
The canonical SMILES for 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium is CO.Oc1ccc2c(c1)CNC2.[Y].
What is the InChIKey of 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium?
The InChIKey is SBFUUQSQFBCVQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO.CH4O.Y/c10-8-2-1-6-4-9-5-7(6)3-8;1-2;/h1-3,9-10H,4-5H2;2H,1H3;.
What are the key properties of 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium?
2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium has a molecular weight of 256.11 g/mol, XLogP of 0.60, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-isoindol-5-ol;methanol;yttrium is sourced from PubChem (CID 166486218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).