C8HF15O — CID 166486265
1,1,1,2,2,4,4,4-octafluoro-3-(2,3,3,3-tetrafluoroprop-1-enoxy)-3-(trifluoromethyl)butane (PubChem CID 166486265) has the molecular formula C8HF15O and a molecular weight of 398.07 g/mol. Its IUPAC name is 1,1,1,2,2,4,4,4-octafluoro-3-(2,3,3,3-tetrafluoroprop-1-enoxy)-3-(trifluoromethyl)butane.
| Compound Name | 1,1,1,2,2,4,4,4-octafluoro-3-(2,3,3,3-tetrafluoroprop-1-enoxy)-3-(trifluoromethyl)butane |
|---|---|
| PubChem CID | 166486265 |
| Molecular Formula | C8HF15O |
| Molecular Weight | 398.07 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 1,1,1,2,2,4,4,4-octafluoro-3-(2,3,3,3-tetrafluoroprop-1-enoxy)-3-(trifluoromethyl)butane |
| SMILES | FC(=COC(C(F)(F)F)(C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8HF15O/c9-2(3(10,11)12)1-24-4(6(15,16)17,7(18,19)20)5(13,14)8(21,22)23/h1H |
| InChIKey | KOVJOPPBAYRBEE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.07 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|