C17H23BrO3 — CID 166487040
1-(4-bromophenoxy)-3-(3-cyclopropylprop-2-ynoxy)propan-2-ol;ethane (PubChem CID 166487040) has the molecular formula C17H23BrO3 and a molecular weight of 355.27 g/mol. Its IUPAC name is 1-(4-bromophenoxy)-3-(3-cyclopropylprop-2-ynoxy)propan-2-ol;ethane.
| Compound Name | 1-(4-bromophenoxy)-3-(3-cyclopropylprop-2-ynoxy)propan-2-ol;ethane |
|---|---|
| PubChem CID | 166487040 |
| Molecular Formula | C17H23BrO3 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-(4-bromophenoxy)-3-(3-cyclopropylprop-2-ynoxy)propan-2-ol;ethane |
| SMILES | CC.OC(COCC#CC1CC1)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H17BrO3.C2H6/c16-13-5-7-15(8-6-13)19-11-14(17)10-18-9-1-2-12-3-4-12;1-2/h5-8,12,14,17H,3-4,9-11H2;1-2H3 |
| InChIKey | WURIGNONTMEYEZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|