About N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide
N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 16648735) has the molecular formula C17H15FN2O2S
and a molecular weight of 330.38 g/mol. Its IUPAC name is N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
Molecular Properties
| Compound Name | N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| PubChem CID | 16648735 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ncc(Cc3ccc(F)cc3)s2)c(C)o1 |
| InChI | InChI=1S/C17H15FN2O2S/c1-10-7-15(11(2)22-10)16(21)20-17-19-9-14(23-17)8-12-3-5-13(18)6-4-12/h3-7,9H,8H2,1-2H3,(H,19,20,21) |
| InChIKey | NIJWPGRRLKRNBG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide?
The IUPAC name of N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide (CID 16648735) is N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide.
What is the SMILES notation for N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide?
The canonical SMILES for N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide is Cc1cc(C(=O)Nc2ncc(Cc3ccc(F)cc3)s2)c(C)o1.
What is the InChIKey of N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide?
The InChIKey is NIJWPGRRLKRNBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15FN2O2S/c1-10-7-15(11(2)22-10)16(21)20-17-19-9-14(23-17)8-12-3-5-13(18)6-4-12/h3-7,9H,8H2,1-2H3,(H,19,20,21).
What are the key properties of N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide?
N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide has a molecular weight of 330.38 g/mol, XLogP of 4.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-[(4-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2,5-dimethylfuran-3-carboxamide is sourced from PubChem (CID 16648735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).