C27H41N5OS — CID 166488156
O-ethyl 4-(1,2,3,4-tetrahydroisoquinolin-5-yl)piperazine-1-carbothioate;N-methylmethanamine;5,6,7,8-tetrahydroquinoline (PubChem CID 166488156) has the molecular formula C27H41N5OS and a molecular weight of 483.73 g/mol. Its IUPAC name is O-ethyl 4-(1,2,3,4-tetrahydroisoquinolin-5-yl)piperazine-1-carbothioate;N-methylmethanamine;5,6,7,8-tetrahydroquinoline.
| Compound Name | O-ethyl 4-(1,2,3,4-tetrahydroisoquinolin-5-yl)piperazine-1-carbothioate;N-methylmethanamine;5,6,7,8-tetrahydroquinoline |
|---|---|
| PubChem CID | 166488156 |
| Molecular Formula | C27H41N5OS |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.30 |
| IUPAC Name | O-ethyl 4-(1,2,3,4-tetrahydroisoquinolin-5-yl)piperazine-1-carbothioate;N-methylmethanamine;5,6,7,8-tetrahydroquinoline |
| SMILES | CCOC(=S)N1CCN(c2cccc3c2CCNC3)CC1.CNC.c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H23N3OS.C9H11N.C2H7N/c1-2-20-16(21)19-10-8-18(9-11-19)15-5-3-4-13-12-17-7-6-14(13)15;1-2-6-9-8(4-1)5-3-7-10-9;1-3-2/h3-5,17H,2,6-12H2,1H3;3,5,7H,1-2,4,6H2;3H,1-2H3 |
| InChIKey | BPWVUNRKVWFEME-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|