About 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine
4-butyl-1-ethyl-3,4-dihydro-2H-pyridine (PubChem CID 166488198) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 166488198 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine |
| SMILES | CCCCC1C=CN(CC)CC1 |
| InChI | InChI=1S/C11H21N/c1-3-5-6-11-7-9-12(4-2)10-8-11/h7,9,11H,3-6,8,10H2,1-2H3 |
| InChIKey | RXCSHSMAKAZTHC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine (CID 166488198) is 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine is CCCCC1C=CN(CC)CC1.
What is the InChIKey of 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine?
The InChIKey is RXCSHSMAKAZTHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N/c1-3-5-6-11-7-9-12(4-2)10-8-11/h7,9,11H,3-6,8,10H2,1-2H3.
What are the key properties of 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine?
4-butyl-1-ethyl-3,4-dihydro-2H-pyridine has a molecular weight of 167.30 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1-ethyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 166488198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).