C20H15ClF2N6S2 — CID 166489183
4-[6-chloro-4-[(1-ethenylsulfanylazetidin-3-yl)amino]-8-fluoroquinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine (PubChem CID 166489183) has the molecular formula C20H15ClF2N6S2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 4-[6-chloro-4-[(1-ethenylsulfanylazetidin-3-yl)amino]-8-fluoroquinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine.
| Compound Name | 4-[6-chloro-4-[(1-ethenylsulfanylazetidin-3-yl)amino]-8-fluoroquinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 166489183 |
| Molecular Formula | C20H15ClF2N6S2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.05 |
| IUPAC Name | 4-[6-chloro-4-[(1-ethenylsulfanylazetidin-3-yl)amino]-8-fluoroquinazolin-7-yl]-7-fluoro-1,3-benzothiazol-2-amine |
| SMILES | C=CSN1CC(Nc2ncnc3c(F)c(-c4ccc(F)c5sc(N)nc45)c(Cl)cc23)C1 |
| InChI | InChI=1S/C20H15ClF2N6S2/c1-2-30-29-6-9(7-29)27-19-11-5-12(21)14(15(23)16(11)25-8-26-19)10-3-4-13(22)18-17(10)28-20(24)31-18/h2-5,8-9H,1,6-7H2,(H2,24,28)(H,25,26,27) |
| InChIKey | UZFWMWIDCVRSQW-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|