C10H18FNO — CID 166489515
(2S,8S)-8-(ethoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 166489515) has the molecular formula C10H18FNO and a molecular weight of 187.26 g/mol. Its IUPAC name is (2S,8S)-8-(ethoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2S,8S)-8-(ethoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 166489515 |
| Molecular Formula | C10H18FNO |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (2S,8S)-8-(ethoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CCOC[C@@]12CCCN1C[C@@H](F)C2 |
| InChI | InChI=1S/C10H18FNO/c1-2-13-8-10-4-3-5-12(10)7-9(11)6-10/h9H,2-8H2,1H3/t9-,10-/m0/s1 |
| InChIKey | RDEMTUFXKIIAPJ-UWVGGRQHSA-N |
| XLogP | 1.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |