C34H33F2N7O3S — CID 166489755
1-[4-[7-(2-amino-7-fluoro-1,3-benzothiazol-4-yl)-8-fluoro-6-(furan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 166489755) has the molecular formula C34H33F2N7O3S and a molecular weight of 657.75 g/mol. Its IUPAC name is 1-[4-[7-(2-amino-7-fluoro-1,3-benzothiazol-4-yl)-8-fluoro-6-(furan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[7-(2-amino-7-fluoro-1,3-benzothiazol-4-yl)-8-fluoro-6-(furan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166489755 |
| Molecular Formula | C34H33F2N7O3S |
| Molecular Weight | 657.75 g/mol |
| Exact Mass | 657.23 |
| IUPAC Name | 1-[4-[7-(2-amino-7-fluoro-1,3-benzothiazol-4-yl)-8-fluoro-6-(furan-3-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4ccc(F)c5sc(N)nc45)c(-c4ccoc4)cc23)CC1 |
| InChI | InChI=1S/C34H33F2N7O3S/c1-2-25(44)41-12-14-42(15-13-41)31-23-17-22(20-7-16-45-18-20)26(21-5-6-24(35)30-29(21)38-32(37)47-30)27(36)28(23)39-33(40-31)46-19-34-8-3-10-43(34)11-4-9-34/h2,5-7,16-18H,1,3-4,8-15,19H2,(H2,37,38) |
| InChIKey | QBOCEIGPKBNFFY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|