C9H16F3O4P — CID 166490002
butyl prop-2-enyl 2,2,2-trifluoroethyl phosphate (PubChem CID 166490002) has the molecular formula C9H16F3O4P and a molecular weight of 276.19 g/mol. Its IUPAC name is butyl prop-2-enyl 2,2,2-trifluoroethyl phosphate.
| Compound Name | butyl prop-2-enyl 2,2,2-trifluoroethyl phosphate |
|---|---|
| PubChem CID | 166490002 |
| Molecular Formula | C9H16F3O4P |
| Molecular Weight | 276.19 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | butyl prop-2-enyl 2,2,2-trifluoroethyl phosphate |
| SMILES | C=CCOP(=O)(OCCCC)OCC(F)(F)F |
| InChI | InChI=1S/C9H16F3O4P/c1-3-5-7-15-17(13,14-6-4-2)16-8-9(10,11)12/h4H,2-3,5-8H2,1H3 |
| InChIKey | QAGPWLKEWKSVQM-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.19 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|