C22H20N4O2S — CID 166490584
3-[4-[5-(2,6-dimethyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 166490584) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 3-[4-[5-(2,6-dimethyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-[4-[5-(2,6-dimethyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 166490584 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 3-[4-[5-(2,6-dimethyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | Cc1cc(-c2[nH]ncc2-c2ccc(-c3cccc(S(N)(=O)=O)c3)cc2)cc(C)n1 |
| InChI | InChI=1S/C22H20N4O2S/c1-14-10-19(11-15(2)25-14)22-21(13-24-26-22)17-8-6-16(7-9-17)18-4-3-5-20(12-18)29(23,27)28/h3-13H,1-2H3,(H,24,26)(H2,23,27,28) |
| InChIKey | WGWMFTZBMNPELG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |