C24H24N4S — CID 166490589
S-[2,3-dimethyl-4-[4-[5-methyl-3-(2-methyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]phenyl]thiohydroxylamine (PubChem CID 166490589) has the molecular formula C24H24N4S and a molecular weight of 400.55 g/mol. Its IUPAC name is S-[2,3-dimethyl-4-[4-[5-methyl-3-(2-methyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]phenyl]thiohydroxylamine.
| Compound Name | S-[2,3-dimethyl-4-[4-[5-methyl-3-(2-methyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 166490589 |
| Molecular Formula | C24H24N4S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | S-[2,3-dimethyl-4-[4-[5-methyl-3-(2-methyl-4-pyridinyl)-1H-pyrazol-4-yl]phenyl]phenyl]thiohydroxylamine |
| SMILES | Cc1cc(-c2n[nH]c(C)c2-c2ccc(-c3ccc(SN)c(C)c3C)cc2)ccn1 |
| InChI | InChI=1S/C24H24N4S/c1-14-13-20(11-12-26-14)24-23(17(4)27-28-24)19-7-5-18(6-8-19)21-9-10-22(29-25)16(3)15(21)2/h5-13H,25H2,1-4H3,(H,27,28) |
| InChIKey | BGFNHYRPAOYHKF-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|