C24H20ClF3N4OS — CID 166491107
(4S)-6-[(E)-4-chlorobut-2-enoyl]-4-[2-[1-ethyl-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carbonitrile (PubChem CID 166491107) has the molecular formula C24H20ClF3N4OS and a molecular weight of 504.97 g/mol. Its IUPAC name is (4S)-6-[(E)-4-chlorobut-2-enoyl]-4-[2-[1-ethyl-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carbonitrile.
| Compound Name | (4S)-6-[(E)-4-chlorobut-2-enoyl]-4-[2-[1-ethyl-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 166491107 |
| Molecular Formula | C24H20ClF3N4OS |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | (4S)-6-[(E)-4-chlorobut-2-enoyl]-4-[2-[1-ethyl-3-(trifluoromethyl)pyrazol-4-yl]phenyl]-5,7-dihydro-4H-thieno[2,3-c]pyridine-2-carbonitrile |
| SMILES | CCn1cc(-c2ccccc2[C@@H]2CN(C(=O)/C=C/CCl)Cc3sc(C#N)cc32)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C24H20ClF3N4OS/c1-2-32-13-20(23(30-32)24(26,27)28)17-7-4-3-6-16(17)19-12-31(22(33)8-5-9-25)14-21-18(19)10-15(11-29)34-21/h3-8,10,13,19H,2,9,12,14H2,1H3/b8-5+/t19-/m0/s1 |
| InChIKey | QVZYEMKZTNJUIM-MEQKGCOVSA-N |
| XLogP | 5.79 |
| TPSA | 61.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|