About CID 166491542
CID 166491542 (PubChem CID 166491542) has the molecular formula C10H16BN
and a molecular weight of 161.06 g/mol.
Molecular Properties
| Compound Name | CID 166491542 |
| PubChem CID | 166491542 |
| Molecular Formula | C10H16BN |
| Molecular Weight | 161.06 g/mol |
| Exact Mass | 161.14 |
| IUPAC Name | — |
| SMILES | CC.[B]c1cc(C(C)C)ccn1 |
| InChI | InChI=1S/C8H10BN.C2H6/c1-6(2)7-3-4-10-8(9)5-7;1-2/h3-6H,1-2H3;1-2H3 |
| InChIKey | LSUUQMWJPFJOMO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.06 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 166491542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166491542?
The IUPAC name of CID 166491542 (CID 166491542) is not available.
What is the SMILES notation for CID 166491542?
The canonical SMILES for CID 166491542 is CC.[B]c1cc(C(C)C)ccn1.
What is the InChIKey of CID 166491542?
The InChIKey is LSUUQMWJPFJOMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BN.C2H6/c1-6(2)7-3-4-10-8(9)5-7;1-2/h3-6H,1-2H3;1-2H3.
What are the key properties of CID 166491542?
CID 166491542 has a molecular weight of 161.06 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166491542 is sourced from PubChem (CID 166491542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).