C24H30N6O2S — CID 166492997
3-amino-N-[(6S)-2-[(3R,4R)-3-amino-4-methoxypiperidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 166492997) has the molecular formula C24H30N6O2S and a molecular weight of 466.61 g/mol. Its IUPAC name is 3-amino-N-[(6S)-2-[(3R,4R)-3-amino-4-methoxypiperidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(6S)-2-[(3R,4R)-3-amino-4-methoxypiperidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166492997 |
| Molecular Formula | C24H30N6O2S |
| Molecular Weight | 466.61 g/mol |
| Exact Mass | 466.22 |
| IUPAC Name | 3-amino-N-[(6S)-2-[(3R,4R)-3-amino-4-methoxypiperidin-1-yl]-5,6,7,8-tetrahydroquinolin-6-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CO[C@@H]1CCN(c2ccc3c(n2)CC[C@H](NC(=O)c2sc4nc(C)ccc4c2N)C3)C[C@H]1N |
| InChI | InChI=1S/C24H30N6O2S/c1-13-3-6-16-21(26)22(33-24(16)27-13)23(31)28-15-5-7-18-14(11-15)4-8-20(29-18)30-10-9-19(32-2)17(25)12-30/h3-4,6,8,15,17,19H,5,7,9-12,25-26H2,1-2H3,(H,28,31)/t15-,17+,19+/m0/s1 |
| InChIKey | QSWQKJDWLUQETM-KVSKMBFKSA-N |
| XLogP | 2.42 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.61 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |