C26H26F5N5O2S — CID 166493063
3-amino-N-[(3R)-7-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3,4-dihydro-2H-chromen-3-yl]-6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 166493063) has the molecular formula C26H26F5N5O2S and a molecular weight of 567.58 g/mol. Its IUPAC name is 3-amino-N-[(3R)-7-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3,4-dihydro-2H-chromen-3-yl]-6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(3R)-7-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3,4-dihydro-2H-chromen-3-yl]-6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 166493063 |
| Molecular Formula | C26H26F5N5O2S |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 567.17 |
| IUPAC Name | 3-amino-N-[(3R)-7-(9,9-difluoro-3,7-diazabicyclo[3.3.1]nonan-3-yl)-3,4-dihydro-2H-chromen-3-yl]-6-methyl-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)c2c(N)c(C(=O)N[C@H]3COc4cc(N5CC6CNCC(C5)C6(F)F)ccc4C3)sc2n1 |
| InChI | InChI=1S/C26H26F5N5O2S/c1-12-4-18(26(29,30)31)20-21(32)22(39-24(20)34-12)23(37)35-16-5-13-2-3-17(6-19(13)38-11-16)36-9-14-7-33-8-15(10-36)25(14,27)28/h2-4,6,14-16,33H,5,7-11,32H2,1H3,(H,35,37)/t14?,15?,16-/m1/s1 |
| InChIKey | AYSHEFCWPSAXND-UYSNPLJNSA-N |
| XLogP | 4.23 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |