C13H15FN4OS — CID 16649463
2-[3-(2-fluorophenyl)triazol-4-yl]sulfanyl-N-propan-2-ylacetamide (PubChem CID 16649463) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[3-(2-fluorophenyl)triazol-4-yl]sulfanyl-N-propan-2-ylacetamide.
| Compound Name | 2-[3-(2-fluorophenyl)triazol-4-yl]sulfanyl-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 16649463 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[3-(2-fluorophenyl)triazol-4-yl]sulfanyl-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CSc1cnnn1-c1ccccc1F |
| InChI | InChI=1S/C13H15FN4OS/c1-9(2)16-12(19)8-20-13-7-15-17-18(13)11-6-4-3-5-10(11)14/h3-7,9H,8H2,1-2H3,(H,16,19) |
| InChIKey | SZYTYBIMWNEQSV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |