About (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate
(1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate (PubChem CID 166494697) has the molecular formula C20H30N2O2
and a molecular weight of 330.47 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate |
| PubChem CID | 166494697 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate |
| SMILES | CN1CCC(OC(=O)N2CC(Cc3ccccc3)CC2(C)C)CC1 |
| InChI | InChI=1S/C20H30N2O2/c1-20(2)14-17(13-16-7-5-4-6-8-16)15-22(20)19(23)24-18-9-11-21(3)12-10-18/h4-8,17-18H,9-15H2,1-3H3 |
| InChIKey | UILCPALGBONKSK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate?
The IUPAC name of (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate (CID 166494697) is (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate?
The canonical SMILES for (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate is CN1CCC(OC(=O)N2CC(Cc3ccccc3)CC2(C)C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate?
The InChIKey is UILCPALGBONKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O2/c1-20(2)14-17(13-16-7-5-4-6-8-16)15-22(20)19(23)24-18-9-11-21(3)12-10-18/h4-8,17-18H,9-15H2,1-3H3.
What are the key properties of (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate?
(1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate has a molecular weight of 330.47 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 4-benzyl-2,2-dimethylpyrrolidine-1-carboxylate is sourced from PubChem (CID 166494697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).