About 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine
1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine (PubChem CID 166496627) has the molecular formula C15H27F2NO
and a molecular weight of 275.38 g/mol. Its IUPAC name is 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine.
Molecular Properties
| Compound Name | 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine |
| PubChem CID | 166496627 |
| Molecular Formula | C15H27F2NO |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine |
| SMILES | CCOCC1CC(CN2CCC(CC)C(F)(F)C2)C1 |
| InChI | InChI=1S/C15H27F2NO/c1-3-14-5-6-18(11-15(14,16)17)9-12-7-13(8-12)10-19-4-2/h12-14H,3-11H2,1-2H3 |
| InChIKey | PIPOFCHTGZLKLQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine?
The IUPAC name of 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine (CID 166496627) is 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine.
What is the SMILES notation for 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine?
The canonical SMILES for 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine is CCOCC1CC(CN2CCC(CC)C(F)(F)C2)C1.
What is the InChIKey of 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine?
The InChIKey is PIPOFCHTGZLKLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27F2NO/c1-3-14-5-6-18(11-15(14,16)17)9-12-7-13(8-12)10-19-4-2/h12-14H,3-11H2,1-2H3.
What are the key properties of 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine?
1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine has a molecular weight of 275.38 g/mol, XLogP of 3.42, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(ethoxymethyl)cyclobutyl]methyl]-4-ethyl-3,3-difluoropiperidine is sourced from PubChem (CID 166496627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).