About CID 166496862
CID 166496862 (PubChem CID 166496862) has the molecular formula C39H45F3IrNO3-
and a molecular weight of 825.00 g/mol.
Molecular Properties
| Compound Name | CID 166496862 |
| PubChem CID | 166496862 |
| Molecular Formula | C39H45F3IrNO3- |
| Molecular Weight | 825.00 g/mol |
| Exact Mass | 825.30 |
| IUPAC Name | — |
| SMILES | CCC(CC(F)(F)F)C(=O)/C(C)=C(\O)C(CC)CC.Cc1ccc2[c-]c3c(c(C)c2c1)Oc1cc(CC(C)C)cc2ccnc-3c12.[Ir] |
| InChI | InChI=1S/C25H22NO.C14H23F3O2.Ir/c1-14(2)9-17-11-19-7-8-26-24-21-13-18-6-5-15(3)10-20(18)16(4)25(21)27-22(12-17)23(19)24;1-5-10(6-2)12(18)9(4)13(19)11(7-3)8-14(15,16)17;/h5-8,10-12,14H,9H2,1-4H3;10-11,18H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | ZKLMMUQNIGVKJV-DZTQYQPZSA-N |
| XLogP | 11.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 825.00 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze CID 166496862 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 166496862?
The IUPAC name of CID 166496862 (CID 166496862) is not available.
What is the SMILES notation for CID 166496862?
The canonical SMILES for CID 166496862 is CCC(CC(F)(F)F)C(=O)/C(C)=C(\O)C(CC)CC.Cc1ccc2[c-]c3c(c(C)c2c1)Oc1cc(CC(C)C)cc2ccnc-3c12.[Ir].
What is the InChIKey of CID 166496862?
The InChIKey is ZKLMMUQNIGVKJV-DZTQYQPZSA-N. The full InChI is InChI=1S/C25H22NO.C14H23F3O2.Ir/c1-14(2)9-17-11-19-7-8-26-24-21-13-18-6-5-15(3)10-20(18)16(4)25(21)27-22(12-17)23(19)24;1-5-10(6-2)12(18)9(4)13(19)11(7-3)8-14(15,16)17;/h5-8,10-12,14H,9H2,1-4H3;10-11,18H,5-8H2,1-4H3;/q-1;;/b;12-9-;.
What are the key properties of CID 166496862?
CID 166496862 has a molecular weight of 825.00 g/mol, XLogP of 11.58, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 166496862 is sourced from PubChem (CID 166496862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).