C24H25N5O3S — CID 166498264
3,7,7,16-tetramethyl-15-(1-methylsulfonylindol-4-yl)-13-oxa-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,10(14),15-pentaene (PubChem CID 166498264) has the molecular formula C24H25N5O3S and a molecular weight of 463.56 g/mol. Its IUPAC name is 3,7,7,16-tetramethyl-15-(1-methylsulfonylindol-4-yl)-13-oxa-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,10(14),15-pentaene.
| Compound Name | 3,7,7,16-tetramethyl-15-(1-methylsulfonylindol-4-yl)-13-oxa-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,10(14),15-pentaene |
|---|---|
| PubChem CID | 166498264 |
| Molecular Formula | C24H25N5O3S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | 3,7,7,16-tetramethyl-15-(1-methylsulfonylindol-4-yl)-13-oxa-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.010,14]hexadeca-1(9),3,5,10(14),15-pentaene |
| SMILES | Cc1c(-c2cccc3c2ccn3S(C)(=O)=O)c2c(c3c1-n1c(C)nnc1C(C)(C)N3)CCO2 |
| InChI | InChI=1S/C24H25N5O3S/c1-13-19(16-7-6-8-18-15(16)9-11-28(18)33(5,30)31)22-17(10-12-32-22)20-21(13)29-14(2)26-27-23(29)24(3,4)25-20/h6-9,11,25H,10,12H2,1-5H3 |
| InChIKey | NGFSQPWOFXQDHM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 91.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |