About piperidine-1-carbonyl piperazine-1-carboxylate
piperidine-1-carbonyl piperazine-1-carboxylate (PubChem CID 166498509) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is piperidine-1-carbonyl piperazine-1-carboxylate.
Molecular Properties
| Compound Name | piperidine-1-carbonyl piperazine-1-carboxylate |
| PubChem CID | 166498509 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | piperidine-1-carbonyl piperazine-1-carboxylate |
| SMILES | O=C(OC(=O)N1CCNCC1)N1CCCCC1 |
| InChI | InChI=1S/C11H19N3O3/c15-10(13-6-2-1-3-7-13)17-11(16)14-8-4-12-5-9-14/h12H,1-9H2 |
| InChIKey | VREOMCWUMADIFL-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze piperidine-1-carbonyl piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-1-carbonyl piperazine-1-carboxylate?
The IUPAC name of piperidine-1-carbonyl piperazine-1-carboxylate (CID 166498509) is piperidine-1-carbonyl piperazine-1-carboxylate.
What is the SMILES notation for piperidine-1-carbonyl piperazine-1-carboxylate?
The canonical SMILES for piperidine-1-carbonyl piperazine-1-carboxylate is O=C(OC(=O)N1CCNCC1)N1CCCCC1.
What is the InChIKey of piperidine-1-carbonyl piperazine-1-carboxylate?
The InChIKey is VREOMCWUMADIFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c15-10(13-6-2-1-3-7-13)17-11(16)14-8-4-12-5-9-14/h12H,1-9H2.
What are the key properties of piperidine-1-carbonyl piperazine-1-carboxylate?
piperidine-1-carbonyl piperazine-1-carboxylate has a molecular weight of 241.29 g/mol, XLogP of 0.63, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-1-carbonyl piperazine-1-carboxylate is sourced from PubChem (CID 166498509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).