About 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide
1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide (PubChem CID 166499571) has the molecular formula C13H14BrF2NO2S
and a molecular weight of 366.23 g/mol. Its IUPAC name is 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 166499571 |
| Molecular Formula | C13H14BrF2NO2S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C=C1c2ccc(Br)c(F)c2OC[C@@H]1F)S(N)=O |
| InChI | InChI=1S/C13H14BrF2NO2S/c1-13(2,20(17)18)5-8-7-3-4-9(14)11(16)12(7)19-6-10(8)15/h3-5,10H,6,17H2,1-2H3/t10-,20?/m0/s1 |
| InChIKey | RQZCHWULSSOLQL-SMNKDYLDSA-N |
| XLogP | 3.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide (CID 166499571) is 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide is CC(C)(C=C1c2ccc(Br)c(F)c2OC[C@@H]1F)S(N)=O.
What is the InChIKey of 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is RQZCHWULSSOLQL-SMNKDYLDSA-N. The full InChI is InChI=1S/C13H14BrF2NO2S/c1-13(2,20(17)18)5-8-7-3-4-9(14)11(16)12(7)19-6-10(8)15/h3-5,10H,6,17H2,1-2H3/t10-,20?/m0/s1.
What are the key properties of 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide?
1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 366.23 g/mol, XLogP of 3.10, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-7-bromo-3,8-difluoro-2,3-dihydrochromen-4-ylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 166499571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).