C18H10BrF7N2O2 — CID 166499622
(2R,4S)-7-bromo-8'-(difluoromethoxy)-2,8-difluoro-6'-(trifluoromethyl)spiro[2,3-dihydronaphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-1-one (PubChem CID 166499622) has the molecular formula C18H10BrF7N2O2 and a molecular weight of 499.18 g/mol. Its IUPAC name is (2R,4S)-7-bromo-8'-(difluoromethoxy)-2,8-difluoro-6'-(trifluoromethyl)spiro[2,3-dihydronaphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-1-one.
| Compound Name | (2R,4S)-7-bromo-8'-(difluoromethoxy)-2,8-difluoro-6'-(trifluoromethyl)spiro[2,3-dihydronaphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-1-one |
|---|---|
| PubChem CID | 166499622 |
| Molecular Formula | C18H10BrF7N2O2 |
| Molecular Weight | 499.18 g/mol |
| Exact Mass | 497.98 |
| IUPAC Name | (2R,4S)-7-bromo-8'-(difluoromethoxy)-2,8-difluoro-6'-(trifluoromethyl)spiro[2,3-dihydronaphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-1-one |
| SMILES | O=C1c2c(ccc(Br)c2F)[C@@]2(C[C@H]1F)CN1C=C(C(F)(F)F)C=C(OC(F)F)C1=N2 |
| InChI | InChI=1S/C18H10BrF7N2O2/c19-9-2-1-8-12(13(9)21)14(29)10(20)4-17(8)6-28-5-7(18(24,25)26)3-11(15(28)27-17)30-16(22)23/h1-3,5,10,16H,4,6H2/t10-,17-/m1/s1 |
| InChIKey | ZIORQIBHOFHHHI-BMLIUANNSA-N |
| XLogP | 5.01 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.18 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |