C17H10F8N2O2 — CID 166499656
(3R,4S)-8'-(difluoromethoxy)-3,7,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydrochromene-4,2'-3H-imidazo[1,2-a]pyridine] (PubChem CID 166499656) has the molecular formula C17H10F8N2O2 and a molecular weight of 426.26 g/mol. Its IUPAC name is (3R,4S)-8'-(difluoromethoxy)-3,7,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydrochromene-4,2'-3H-imidazo[1,2-a]pyridine].
| Compound Name | (3R,4S)-8'-(difluoromethoxy)-3,7,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydrochromene-4,2'-3H-imidazo[1,2-a]pyridine] |
|---|---|
| PubChem CID | 166499656 |
| Molecular Formula | C17H10F8N2O2 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | (3R,4S)-8'-(difluoromethoxy)-3,7,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydrochromene-4,2'-3H-imidazo[1,2-a]pyridine] |
| SMILES | Fc1ccc2c(c1F)OC[C@H](F)[C@@]21CN2C=C(C(F)(F)F)C=C(OC(F)F)C2=N1 |
| InChI | InChI=1S/C17H10F8N2O2/c18-9-2-1-8-13(12(9)20)28-5-11(19)16(8)6-27-4-7(17(23,24)25)3-10(14(27)26-16)29-15(21)22/h1-4,11,15H,5-6H2/t11-,16+/m0/s1 |
| InChIKey | MZSMZEBNJWAARN-MEDUHNTESA-N |
| XLogP | 4.19 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |