C19H12F7N3O — CID 166499676
(2S,8'S)-8-(difluoromethoxy)-1',8'-difluoro-6-(trifluoromethyl)spiro[3H-imidazo[1,2-a]pyridine-2,5'-7,8-dihydro-6H-naphthalene]-2'-carbonitrile (PubChem CID 166499676) has the molecular formula C19H12F7N3O and a molecular weight of 431.31 g/mol. Its IUPAC name is (2S,8'S)-8-(difluoromethoxy)-1',8'-difluoro-6-(trifluoromethyl)spiro[3H-imidazo[1,2-a]pyridine-2,5'-7,8-dihydro-6H-naphthalene]-2'-carbonitrile.
| Compound Name | (2S,8'S)-8-(difluoromethoxy)-1',8'-difluoro-6-(trifluoromethyl)spiro[3H-imidazo[1,2-a]pyridine-2,5'-7,8-dihydro-6H-naphthalene]-2'-carbonitrile |
|---|---|
| PubChem CID | 166499676 |
| Molecular Formula | C19H12F7N3O |
| Molecular Weight | 431.31 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | (2S,8'S)-8-(difluoromethoxy)-1',8'-difluoro-6-(trifluoromethyl)spiro[3H-imidazo[1,2-a]pyridine-2,5'-7,8-dihydro-6H-naphthalene]-2'-carbonitrile |
| SMILES | N#Cc1ccc2c(c1F)[C@@H](F)CC[C@@]21CN2C=C(C(F)(F)F)C=C(OC(F)F)C2=N1 |
| InChI | InChI=1S/C19H12F7N3O/c20-12-3-4-18(11-2-1-9(6-27)15(21)14(11)12)8-29-7-10(19(24,25)26)5-13(16(29)28-18)30-17(22)23/h1-2,5,7,12,17H,3-4,8H2/t12-,18+/m0/s1 |
| InChIKey | PWPBOTBNSLMIIL-KPZWWZAWSA-N |
| XLogP | 4.99 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.31 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |