C18H12BrF4N3O — CID 166499716
(1R,4S)-7-bromo-8'-(difluoromethoxy)-1,8-difluorospiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-6'-carbonitrile (PubChem CID 166499716) has the molecular formula C18H12BrF4N3O and a molecular weight of 442.21 g/mol. Its IUPAC name is (1R,4S)-7-bromo-8'-(difluoromethoxy)-1,8-difluorospiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-6'-carbonitrile.
| Compound Name | (1R,4S)-7-bromo-8'-(difluoromethoxy)-1,8-difluorospiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-6'-carbonitrile |
|---|---|
| PubChem CID | 166499716 |
| Molecular Formula | C18H12BrF4N3O |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (1R,4S)-7-bromo-8'-(difluoromethoxy)-1,8-difluorospiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine]-6'-carbonitrile |
| SMILES | N#CC1=CN2C[C@@]3(CC[C@@H](F)c4c3ccc(Br)c4F)N=C2C(OC(F)F)=C1 |
| InChI | InChI=1S/C18H12BrF4N3O/c19-11-2-1-10-14(15(11)21)12(20)3-4-18(10)8-26-7-9(6-24)5-13(16(26)25-18)27-17(22)23/h1-2,5,7,12,17H,3-4,8H2/t12-,18-/m1/s1 |
| InChIKey | NCZYADHDLSFLTE-KZULUSFZSA-N |
| XLogP | 4.85 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |