C18H11BrF8N2O — CID 166499781
(1R,2R,4S)-7-bromo-8'-(difluoromethoxy)-1,2,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine] (PubChem CID 166499781) has the molecular formula C18H11BrF8N2O and a molecular weight of 503.19 g/mol. Its IUPAC name is (1R,2R,4S)-7-bromo-8'-(difluoromethoxy)-1,2,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine].
| Compound Name | (1R,2R,4S)-7-bromo-8'-(difluoromethoxy)-1,2,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine] |
|---|---|
| PubChem CID | 166499781 |
| Molecular Formula | C18H11BrF8N2O |
| Molecular Weight | 503.19 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | (1R,2R,4S)-7-bromo-8'-(difluoromethoxy)-1,2,8-trifluoro-6'-(trifluoromethyl)spiro[2,3-dihydro-1H-naphthalene-4,2'-3H-imidazo[1,2-a]pyridine] |
| SMILES | Fc1c(Br)ccc2c1[C@@H](F)[C@H](F)C[C@@]21CN2C=C(C(F)(F)F)C=C(OC(F)F)C2=N1 |
| InChI | InChI=1S/C18H11BrF8N2O/c19-9-2-1-8-12(13(9)21)14(22)10(20)4-17(8)6-29-5-7(18(25,26)27)3-11(15(29)28-17)30-16(23)24/h1-3,5,10,14,16H,4,6H2/t10-,14+,17-/m1/s1 |
| InChIKey | BHGCDOSWUQZQJE-OVWKYPIYSA-N |
| XLogP | 5.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.19 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |