C24H27F5N6O3 — CID 166500215
N-[(S)-(4,4-difluorocyclohexyl)-[7-[1-(4,4,4-trifluorobutanoylamino)ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-3-methyl-1,2-oxazole-4-carboxamide (PubChem CID 166500215) has the molecular formula C24H27F5N6O3 and a molecular weight of 542.51 g/mol. Its IUPAC name is N-[(S)-(4,4-difluorocyclohexyl)-[7-[1-(4,4,4-trifluorobutanoylamino)ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-3-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[1-(4,4,4-trifluorobutanoylamino)ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-3-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 166500215 |
| Molecular Formula | C24H27F5N6O3 |
| Molecular Weight | 542.51 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | N-[(S)-(4,4-difluorocyclohexyl)-[7-[1-(4,4,4-trifluorobutanoylamino)ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-3-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1nocc1C(=O)N[C@H](c1cn2ncc(C(C)NC(=O)CCC(F)(F)F)cc2n1)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H27F5N6O3/c1-13(31-20(36)5-8-24(27,28)29)16-9-19-32-18(11-35(19)30-10-16)21(15-3-6-23(25,26)7-4-15)33-22(37)17-12-38-34-14(17)2/h9-13,15,21H,3-8H2,1-2H3,(H,31,36)(H,33,37)/t13?,21-/m0/s1 |
| InChIKey | XSLKFHZKGPRWMP-KCSFHACMSA-N |
| XLogP | 4.84 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.51 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |