About carbanide;iridium;1-phenylisoquinoline
carbanide;iridium;1-phenylisoquinoline (PubChem CID 166502152) has the molecular formula C16H14IrN-
and a molecular weight of 412.51 g/mol. Its IUPAC name is carbanide;iridium;1-phenylisoquinoline.
Molecular Properties
| Compound Name | carbanide;iridium;1-phenylisoquinoline |
| PubChem CID | 166502152 |
| Molecular Formula | C16H14IrN- |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | carbanide;iridium;1-phenylisoquinoline |
| SMILES | [CH3-].[Ir].c1ccc(-c2nccc3ccccc23)cc1 |
| InChI | InChI=1S/C15H11N.CH3.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;;/h1-11H;1H3;/q;-1; |
| InChIKey | MIOWRKDHJSFGFB-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze carbanide;iridium;1-phenylisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;iridium;1-phenylisoquinoline?
The IUPAC name of carbanide;iridium;1-phenylisoquinoline (CID 166502152) is carbanide;iridium;1-phenylisoquinoline.
What is the SMILES notation for carbanide;iridium;1-phenylisoquinoline?
The canonical SMILES for carbanide;iridium;1-phenylisoquinoline is [CH3-].[Ir].c1ccc(-c2nccc3ccccc23)cc1.
What is the InChIKey of carbanide;iridium;1-phenylisoquinoline?
The InChIKey is MIOWRKDHJSFGFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N.CH3.Ir/c1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;;/h1-11H;1H3;/q;-1;.
What are the key properties of carbanide;iridium;1-phenylisoquinoline?
carbanide;iridium;1-phenylisoquinoline has a molecular weight of 412.51 g/mol, XLogP of 4.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;iridium;1-phenylisoquinoline is sourced from PubChem (CID 166502152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).