C21H22N2 — CID 166503135
2,3,5-trideuterio-6-(2,3,4,5-tetradeuteriophenyl)-4-[2,4,5-trideuterio-6-(1,1-dideuterio-2,2-dimethylpropyl)-3-pyridinyl]pyridine (PubChem CID 166503135) has the molecular formula C21H22N2 and a molecular weight of 314.49 g/mol. Its IUPAC name is 2,3,5-trideuterio-6-(2,3,4,5-tetradeuteriophenyl)-4-[2,4,5-trideuterio-6-(1,1-dideuterio-2,2-dimethylpropyl)-3-pyridinyl]pyridine.
| Compound Name | 2,3,5-trideuterio-6-(2,3,4,5-tetradeuteriophenyl)-4-[2,4,5-trideuterio-6-(1,1-dideuterio-2,2-dimethylpropyl)-3-pyridinyl]pyridine |
|---|---|
| PubChem CID | 166503135 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 2,3,5-trideuterio-6-(2,3,4,5-tetradeuteriophenyl)-4-[2,4,5-trideuterio-6-(1,1-dideuterio-2,2-dimethylpropyl)-3-pyridinyl]pyridine |
| SMILES | [2H]c1cc(-c2nc([2H])c([2H])c(-c3c([2H])nc(C([2H])([2H])C(C)(C)C)c([2H])c3[2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/C21H22N2/c1-21(2,3)14-19-10-9-18(15-23-19)17-11-12-22-20(13-17)16-7-5-4-6-8-16/h4-13,15H,14H2,1-3H3/i4D,5D,6D,7D,9D,10D,11D,12D,13D,14D2,15D |
| InChIKey | MHKIGKKFUZZCKO-NWBBTALQSA-N |
| XLogP | 5.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |