C21H35N3 — CID 166503867
2-[(2R)-1-tert-butylpyrrolidin-2-yl]-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline (PubChem CID 166503867) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is 2-[(2R)-1-tert-butylpyrrolidin-2-yl]-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline.
| Compound Name | 2-[(2R)-1-tert-butylpyrrolidin-2-yl]-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
|---|---|
| PubChem CID | 166503867 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 2-[(2R)-1-tert-butylpyrrolidin-2-yl]-N-methyl-N-[(1-methylpyrrolidin-2-yl)methyl]aniline |
| SMILES | CN(CC1CCCN1C)c1ccccc1[C@H]1CCCN1C(C)(C)C |
| InChI | InChI=1S/C21H35N3/c1-21(2,3)24-15-9-13-20(24)18-11-6-7-12-19(18)23(5)16-17-10-8-14-22(17)4/h6-7,11-12,17,20H,8-10,13-16H2,1-5H3/t17?,20-/m1/s1 |
| InChIKey | VVNYDGIAWNYZJV-UUSAFJCLSA-N |
| XLogP | 4.15 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |