C14H17F2NO2 — CID 166503884
2-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-propan-2-ylpyrrolidine (PubChem CID 166503884) has the molecular formula C14H17F2NO2 and a molecular weight of 269.29 g/mol. Its IUPAC name is 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-propan-2-ylpyrrolidine.
| Compound Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 166503884 |
| Molecular Formula | C14H17F2NO2 |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2,2-difluoro-1,3-benzodioxol-4-yl)-1-propan-2-ylpyrrolidine |
| SMILES | CC(C)N1CCCC1c1cccc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C14H17F2NO2/c1-9(2)17-8-4-6-11(17)10-5-3-7-12-13(10)19-14(15,16)18-12/h3,5,7,9,11H,4,6,8H2,1-2H3 |
| InChIKey | LJDPYIYQKWYLGX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |