C18H23N3O3 — CID 166504060
7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-5,6,7,8-tetrahydroquinoline-2-carboxylic acid (PubChem CID 166504060) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-5,6,7,8-tetrahydroquinoline-2-carboxylic acid.
| Compound Name | 7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-5,6,7,8-tetrahydroquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 166504060 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 7-methyl-4-(4-prop-2-enoylpiperazin-1-yl)-5,6,7,8-tetrahydroquinoline-2-carboxylic acid |
| SMILES | C=CC(=O)N1CCN(c2cc(C(=O)O)nc3c2CCC(C)C3)CC1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-17(22)21-8-6-20(7-9-21)16-11-15(18(23)24)19-14-10-12(2)4-5-13(14)16/h3,11-12H,1,4-10H2,2H3,(H,23,24) |
| InChIKey | IYJIQXNIWYSEBN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|