C23H22F3N5O4 — CID 166504572
(E)-N-[5-[2-methoxy-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]phenyl]-1H-pyrazol-3-yl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 166504572) has the molecular formula C23H22F3N5O4 and a molecular weight of 489.45 g/mol. Its IUPAC name is (E)-N-[5-[2-methoxy-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]phenyl]-1H-pyrazol-3-yl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[5-[2-methoxy-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]phenyl]-1H-pyrazol-3-yl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 166504572 |
| Molecular Formula | C23H22F3N5O4 |
| Molecular Weight | 489.45 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | (E)-N-[5-[2-methoxy-6-[3-[(2,2,2-trifluoroacetyl)amino]propoxy]phenyl]-1H-pyrazol-3-yl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | COc1cccc(OCCCNC(=O)C(F)(F)F)c1-c1cc(NC(=O)/C=C/c2ccncc2)n[nH]1 |
| InChI | InChI=1S/C23H22F3N5O4/c1-34-17-4-2-5-18(35-13-3-10-28-22(33)23(24,25)26)21(17)16-14-19(31-30-16)29-20(32)7-6-15-8-11-27-12-9-15/h2,4-9,11-12,14H,3,10,13H2,1H3,(H,28,33)(H2,29,30,31,32)/b7-6+ |
| InChIKey | MJABOYBWDUQAGS-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|