About (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium
(2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium (PubChem CID 166504829) has the molecular formula C16H23O+
and a molecular weight of 231.36 g/mol. Its IUPAC name is (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium.
Molecular Properties
| Compound Name | (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium |
| PubChem CID | 166504829 |
| Molecular Formula | C16H23O+ |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium |
| SMILES | CC1C2CCC(C)(C2)C1([OH2+])Cc1ccccc1 |
| InChI | InChI=1S/C16H22O/c1-12-14-8-9-15(2,11-14)16(12,17)10-13-6-4-3-5-7-13/h3-7,12,14,17H,8-11H2,1-2H3/p+1 |
| InChIKey | QYXRXUFMMRRFFO-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 22.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium?
The IUPAC name of (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium (CID 166504829) is (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium.
What is the SMILES notation for (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium?
The canonical SMILES for (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium is CC1C2CCC(C)(C2)C1([OH2+])Cc1ccccc1.
What is the InChIKey of (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium?
The InChIKey is QYXRXUFMMRRFFO-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H22O/c1-12-14-8-9-15(2,11-14)16(12,17)10-13-6-4-3-5-7-13/h3-7,12,14,17H,8-11H2,1-2H3/p+1.
What are the key properties of (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium?
(2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium has a molecular weight of 231.36 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-1,3-dimethyl-2-bicyclo[2.2.1]heptanyl)oxidanium is sourced from PubChem (CID 166504829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).