C24H17F6N5O5 — CID 166505775
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-ethyl-2-[7-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-3H-imidazo[4,5-d]pyridazin-5-yl]acetamide (PubChem CID 166505775) has the molecular formula C24H17F6N5O5 and a molecular weight of 569.42 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-ethyl-2-[7-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-3H-imidazo[4,5-d]pyridazin-5-yl]acetamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-ethyl-2-[7-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-3H-imidazo[4,5-d]pyridazin-5-yl]acetamide |
|---|---|
| PubChem CID | 166505775 |
| Molecular Formula | C24H17F6N5O5 |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 569.11 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-N-ethyl-2-[7-[3-fluoro-5-(2,2,2-trifluoroethoxy)phenyl]-4-oxo-3H-imidazo[4,5-d]pyridazin-5-yl]acetamide |
| SMILES | CCN(C(=O)Cn1nc(-c2cc(F)cc(OCC(F)(F)F)c2)c2nc[nH]c2c1=O)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C24H17F6N5O5/c1-2-34(14-3-4-16-17(8-14)40-24(29,30)39-16)18(36)9-35-22(37)21-20(31-11-32-21)19(33-35)12-5-13(25)7-15(6-12)38-10-23(26,27)28/h3-8,11H,2,9-10H2,1H3,(H,31,32) |
| InChIKey | AOIHOTKBNZUGNE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |