About naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate
naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate (PubChem CID 166506026) has the molecular formula C17H21O6PS
and a molecular weight of 384.39 g/mol. Its IUPAC name is naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate.
Molecular Properties
| Compound Name | naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate |
| PubChem CID | 166506026 |
| Molecular Formula | C17H21O6PS |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate |
| SMILES | CC(C)(CSCCOP(=O)(O)O)C(=O)Oc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H21O6PS/c1-17(2,12-25-10-9-22-24(19,20)21)16(18)23-15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11H,9-10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | FCHXMILDLJUOJC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate?
The IUPAC name of naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate (CID 166506026) is naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate.
What is the SMILES notation for naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate?
The canonical SMILES for naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate is CC(C)(CSCCOP(=O)(O)O)C(=O)Oc1ccc2ccccc2c1.
What is the InChIKey of naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate?
The InChIKey is FCHXMILDLJUOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21O6PS/c1-17(2,12-25-10-9-22-24(19,20)21)16(18)23-15-8-7-13-5-3-4-6-14(13)11-15/h3-8,11H,9-10,12H2,1-2H3,(H2,19,20,21).
What are the key properties of naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate?
naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate has a molecular weight of 384.39 g/mol, XLogP of 3.61, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-2-yl 2,2-dimethyl-3-(2-phosphonooxyethylsulfanyl)propanoate is sourced from PubChem (CID 166506026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).