C54H62N2 — CID 166506077
2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)-N-[4-[1-[4-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]cyclohexyl]phenyl]aniline (PubChem CID 166506077) has the molecular formula C54H62N2 and a molecular weight of 739.10 g/mol. Its IUPAC name is 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)-N-[4-[1-[4-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]cyclohexyl]phenyl]aniline.
| Compound Name | 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)-N-[4-[1-[4-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]cyclohexyl]phenyl]aniline |
|---|---|
| PubChem CID | 166506077 |
| Molecular Formula | C54H62N2 |
| Molecular Weight | 739.10 g/mol |
| Exact Mass | 738.49 |
| IUPAC Name | 2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)-N-[4-[1-[4-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)phenyl]cyclohexyl]phenyl]aniline |
| SMILES | Cc1cc(C)c(N(c2ccc(C3(c4ccc(N(c5c(C)cc(C)cc5C)c5c(C)cc(C)cc5C)cc4)CCCCC3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C54H62N2/c1-34-26-38(5)50(39(6)27-34)55(51-40(7)28-35(2)29-41(51)8)48-20-16-46(17-21-48)54(24-14-13-15-25-54)47-18-22-49(23-19-47)56(52-42(9)30-36(3)31-43(52)10)53-44(11)32-37(4)33-45(53)12/h16-23,26-33H,13-15,24-25H2,1-12H3 |
| InChIKey | ALDKHITVQRGSLI-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.10 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |