C2H2F3O2P — CID 166506079
2,4,5-trifluoro-1,3,2-dioxaphospholane (PubChem CID 166506079) has the molecular formula C2H2F3O2P and a molecular weight of 146.00 g/mol. Its IUPAC name is 2,4,5-trifluoro-1,3,2-dioxaphospholane.
| Compound Name | 2,4,5-trifluoro-1,3,2-dioxaphospholane |
|---|---|
| PubChem CID | 166506079 |
| Molecular Formula | C2H2F3O2P |
| Molecular Weight | 146.00 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | 2,4,5-trifluoro-1,3,2-dioxaphospholane |
| SMILES | FC1OP(F)OC1F |
| InChI | InChI=1S/C2H2F3O2P/c3-1-2(4)7-8(5)6-1/h1-2H |
| InChIKey | VSBLSYVEFJNYOY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.00 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|