About 2,4-difluoro-1,3,2-dioxaphospholane
2,4-difluoro-1,3,2-dioxaphospholane (PubChem CID 166506083) has the molecular formula C2H3F2O2P
and a molecular weight of 128.01 g/mol. Its IUPAC name is 2,4-difluoro-1,3,2-dioxaphospholane.
Molecular Properties
| Compound Name | 2,4-difluoro-1,3,2-dioxaphospholane |
| PubChem CID | 166506083 |
| Molecular Formula | C2H3F2O2P |
| Molecular Weight | 128.01 g/mol |
| Exact Mass | 127.98 |
| IUPAC Name | 2,4-difluoro-1,3,2-dioxaphospholane |
| SMILES | FC1COP(F)O1 |
| InChI | InChI=1S/C2H3F2O2P/c3-2-1-5-7(4)6-2/h2H,1H2 |
| InChIKey | OMRKRFQPTYEBDJ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.01 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-1,3,2-dioxaphospholane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-1,3,2-dioxaphospholane?
The IUPAC name of 2,4-difluoro-1,3,2-dioxaphospholane (CID 166506083) is 2,4-difluoro-1,3,2-dioxaphospholane.
What is the SMILES notation for 2,4-difluoro-1,3,2-dioxaphospholane?
The canonical SMILES for 2,4-difluoro-1,3,2-dioxaphospholane is FC1COP(F)O1.
What is the InChIKey of 2,4-difluoro-1,3,2-dioxaphospholane?
The InChIKey is OMRKRFQPTYEBDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3F2O2P/c3-2-1-5-7(4)6-2/h2H,1H2.
What are the key properties of 2,4-difluoro-1,3,2-dioxaphospholane?
2,4-difluoro-1,3,2-dioxaphospholane has a molecular weight of 128.01 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-1,3,2-dioxaphospholane is sourced from PubChem (CID 166506083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).