C8H14N2O2 — CID 166506249
(3R,4S)-1-(2-aminoethyl)-3,4-dimethylpyrrolidine-2,5-dione (PubChem CID 166506249) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is (3R,4S)-1-(2-aminoethyl)-3,4-dimethylpyrrolidine-2,5-dione.
| Compound Name | (3R,4S)-1-(2-aminoethyl)-3,4-dimethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 166506249 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | (3R,4S)-1-(2-aminoethyl)-3,4-dimethylpyrrolidine-2,5-dione |
| SMILES | C[C@@H]1C(=O)N(CCN)C(=O)[C@@H]1C |
| InChI | InChI=1S/C8H14N2O2/c1-5-6(2)8(12)10(4-3-9)7(5)11/h5-6H,3-4,9H2,1-2H3/t5-,6+ |
| InChIKey | QDXOTDCQDTWKNL-OLQVQODUSA-N |
| XLogP | -0.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|