About N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide
N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide (PubChem CID 166506283) has the molecular formula C10H15N3O4S
and a molecular weight of 273.31 g/mol. Its IUPAC name is N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide.
Molecular Properties
| Compound Name | N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide |
| PubChem CID | 166506283 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide |
| SMILES | CNC(=O)CC(=O)NCCCN1C(=O)CSC1=O |
| InChI | InChI=1S/C10H15N3O4S/c1-11-7(14)5-8(15)12-3-2-4-13-9(16)6-18-10(13)17/h2-6H2,1H3,(H,11,14)(H,12,15) |
| InChIKey | BNRIPBHTVFRROM-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide?
The IUPAC name of N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide (CID 166506283) is N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide.
What is the SMILES notation for N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide?
The canonical SMILES for N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide is CNC(=O)CC(=O)NCCCN1C(=O)CSC1=O.
What is the InChIKey of N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide?
The InChIKey is BNRIPBHTVFRROM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O4S/c1-11-7(14)5-8(15)12-3-2-4-13-9(16)6-18-10(13)17/h2-6H2,1H3,(H,11,14)(H,12,15).
What are the key properties of N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide?
N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide has a molecular weight of 273.31 g/mol, XLogP of -0.68, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[3-(2,4-dioxo-1,3-thiazolidin-3-yl)propyl]-N-methylpropanediamide is sourced from PubChem (CID 166506283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).