C19H31N3O4S — CID 166506435
2-[2-[2-(5-tert-butyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide (PubChem CID 166506435) has the molecular formula C19H31N3O4S and a molecular weight of 397.54 g/mol. Its IUPAC name is 2-[2-[2-(5-tert-butyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide.
| Compound Name | 2-[2-[2-(5-tert-butyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide |
|---|---|
| PubChem CID | 166506435 |
| Molecular Formula | C19H31N3O4S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 2-[2-[2-(5-tert-butyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethylamino]-2-oxoethyl]sulfanyl-N-methylacetamide |
| SMILES | CNC(=O)CSCC(=O)NCCN1C(=O)C2CCC(C(C)(C)C)CC2C1=O |
| InChI | InChI=1S/C19H31N3O4S/c1-19(2,3)12-5-6-13-14(9-12)18(26)22(17(13)25)8-7-21-16(24)11-27-10-15(23)20-4/h12-14H,5-11H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | RXQYQUCFFUPKFL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|